C22H18ClN2O6- — CID 2173074
2-chloro-5-[5-[(Z)-(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 2173074) has the molecular formula C22H18ClN2O6- and a molecular weight of 441.85 g/mol. Its IUPAC name is 2-chloro-5-[5-[(Z)-(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | 2-chloro-5-[5-[(Z)-(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2173074 |
| Molecular Formula | C22H18ClN2O6- |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 2-chloro-5-[5-[(Z)-(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | O=C1NC(=O)N(C2CCCCC2)C(=O)/C1=C\c1ccc(-c2ccc(Cl)c(C(=O)[O-])c2)o1 |
| InChI | InChI=1S/C22H19ClN2O6/c23-17-8-6-12(10-15(17)21(28)29)18-9-7-14(31-18)11-16-19(26)24-22(30)25(20(16)27)13-4-2-1-3-5-13/h6-11,13H,1-5H2,(H,28,29)(H,24,26,30)/p-1/b16-11- |
| InChIKey | BPZYGICGBZZDQD-WJDWOHSUSA-M |
| XLogP | 2.76 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|