C22H21F3N2O2S — CID 126083998
(5Z)-3-cyclohexyl-1-methyl-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]imidazolidin-4-one (PubChem CID 126083998) has the molecular formula C22H21F3N2O2S and a molecular weight of 434.48 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-1-methyl-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]imidazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-1-methyl-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]imidazolidin-4-one |
|---|---|
| PubChem CID | 126083998 |
| Molecular Formula | C22H21F3N2O2S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | (5Z)-3-cyclohexyl-1-methyl-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]imidazolidin-4-one |
| SMILES | CN1C(=S)N(C2CCCCC2)C(=O)/C1=C/c1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C22H21F3N2O2S/c1-26-18(20(28)27(21(26)30)16-8-3-2-4-9-16)13-17-10-11-19(29-17)14-6-5-7-15(12-14)22(23,24)25/h5-7,10-13,16H,2-4,8-9H2,1H3/b18-13- |
| InChIKey | GEPJQPVHRJSGIF-AQTBWJFISA-N |
| XLogP | 5.70 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|