C21H20Cl2N2O2S — CID 126094652
(5Z)-3-cyclohexyl-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126094652) has the molecular formula C21H20Cl2N2O2S and a molecular weight of 435.38 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126094652 |
| Molecular Formula | C21H20Cl2N2O2S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=S)N(C2CCCCC2)C(=O)/C1=C/c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C21H20Cl2N2O2S/c1-24-18(20(26)25(21(24)28)14-5-3-2-4-6-14)12-15-8-10-19(27-15)16-9-7-13(22)11-17(16)23/h7-12,14H,2-6H2,1H3/b18-12- |
| InChIKey | WRHBRZOFJKYFFT-PDGQHHTCSA-N |
| XLogP | 5.99 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|