C17H18Cl2N2O2S — CID 5127514
3-cyclohexyl-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 5127514) has the molecular formula C17H18Cl2N2O2S and a molecular weight of 385.32 g/mol. Its IUPAC name is 3-cyclohexyl-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-cyclohexyl-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 5127514 |
| Molecular Formula | C17H18Cl2N2O2S |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 3-cyclohexyl-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=S)N(C2CCCCC2)C(=O)C1=Cc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2O2S/c1-20-14(9-10-7-12(18)15(22)13(19)8-10)16(23)21(17(20)24)11-5-3-2-4-6-11/h7-9,11,22H,2-6H2,1H3 |
| InChIKey | RCMUYUNYGNACJI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|