C17H19IN2O2S — CID 126089141
(5Z)-3-cyclohexyl-5-[(4-hydroxy-3-iodophenyl)methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126089141) has the molecular formula C17H19IN2O2S and a molecular weight of 442.32 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[(4-hydroxy-3-iodophenyl)methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-[(4-hydroxy-3-iodophenyl)methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126089141 |
| Molecular Formula | C17H19IN2O2S |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[(4-hydroxy-3-iodophenyl)methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=S)N(C2CCCCC2)C(=O)/C1=C/c1ccc(O)c(I)c1 |
| InChI | InChI=1S/C17H19IN2O2S/c1-19-14(10-11-7-8-15(21)13(18)9-11)16(22)20(17(19)23)12-5-3-2-4-6-12/h7-10,12,21H,2-6H2,1H3/b14-10- |
| InChIKey | SSMSTFJEGDWOOZ-UVTDQMKNSA-N |
| XLogP | 3.73 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|