C14H13IN2O4S — CID 2188861
methyl 2-[(5Z)-5-[(4-hydroxy-3-iodophenyl)methylidene]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 2188861) has the molecular formula C14H13IN2O4S and a molecular weight of 432.24 g/mol. Its IUPAC name is methyl 2-[(5Z)-5-[(4-hydroxy-3-iodophenyl)methylidene]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-5-[(4-hydroxy-3-iodophenyl)methylidene]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 2188861 |
| Molecular Formula | C14H13IN2O4S |
| Molecular Weight | 432.24 g/mol |
| Exact Mass | 431.96 |
| IUPAC Name | methyl 2-[(5Z)-5-[(4-hydroxy-3-iodophenyl)methylidene]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=S)N(C)C(=O)/C1=C/c1ccc(O)c(I)c1 |
| InChI | InChI=1S/C14H13IN2O4S/c1-16-13(20)10(17(14(16)22)7-12(19)21-2)6-8-3-4-11(18)9(15)5-8/h3-6,18H,7H2,1-2H3/b10-6- |
| InChIKey | DSMPCMBIVOMULP-POHAHGRESA-N |
| XLogP | 1.57 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|