C17H19IN2O5S — CID 1309100
methyl 2-[(5Z)-5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 1309100) has the molecular formula C17H19IN2O5S and a molecular weight of 490.32 g/mol. Its IUPAC name is methyl 2-[(5Z)-5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 1309100 |
| Molecular Formula | C17H19IN2O5S |
| Molecular Weight | 490.32 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | methyl 2-[(5Z)-5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCOc1c(I)cc(/C=C2/C(=O)N(C)C(=S)N2CC(=O)OC)cc1OC |
| InChI | InChI=1S/C17H19IN2O5S/c1-5-25-15-11(18)6-10(8-13(15)23-3)7-12-16(22)19(2)17(26)20(12)9-14(21)24-4/h6-8H,5,9H2,1-4H3/b12-7- |
| InChIKey | DUQSIDSSIZGNDW-GHXNOFRVSA-N |
| XLogP | 2.27 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|