C16H17IN2O2S — CID 126096600
(5Z)-3-cyclohexyl-5-[(4-hydroxy-3-iodophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 126096600) has the molecular formula C16H17IN2O2S and a molecular weight of 428.30 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[(4-hydroxy-3-iodophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-[(4-hydroxy-3-iodophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126096600 |
| Molecular Formula | C16H17IN2O2S |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[(4-hydroxy-3-iodophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(O)c(I)c2)NC(=S)N1C1CCCCC1 |
| InChI | InChI=1S/C16H17IN2O2S/c17-12-8-10(6-7-14(12)20)9-13-15(21)19(16(22)18-13)11-4-2-1-3-5-11/h6-9,11,20H,1-5H2,(H,18,22)/b13-9- |
| InChIKey | LMWGQCTTWWNOSI-LCYFTJDESA-N |
| XLogP | 3.39 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|