C16H12Cl2N2O2S — CID 2180986
(5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 2180986) has the molecular formula C16H12Cl2N2O2S and a molecular weight of 367.26 g/mol. Its IUPAC name is (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 2180986 |
| Molecular Formula | C16H12Cl2N2O2S |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=O)/C(=C/c2ccc(-c3cccc(Cl)c3Cl)o2)N(C)C1=S |
| InChI | InChI=1S/C16H12Cl2N2O2S/c1-19-12(15(21)20(2)16(19)23)8-9-6-7-13(22-9)10-4-3-5-11(17)14(10)18/h3-8H,1-2H3/b12-8- |
| InChIKey | ZURKJQWJXUHQBD-WQLSENKSSA-N |
| XLogP | 4.28 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|