C24H16N4O3 — CID 50883764
(5E)-4-methyl-2,6-dioxo-5-[[5-(4-phenyldiazenylphenyl)furan-2-yl]methylidene]pyridine-3-carbonitrile (PubChem CID 50883764) has the molecular formula C24H16N4O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is (5E)-4-methyl-2,6-dioxo-5-[[5-(4-phenyldiazenylphenyl)furan-2-yl]methylidene]pyridine-3-carbonitrile.
| Compound Name | (5E)-4-methyl-2,6-dioxo-5-[[5-(4-phenyldiazenylphenyl)furan-2-yl]methylidene]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 50883764 |
| Molecular Formula | C24H16N4O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (5E)-4-methyl-2,6-dioxo-5-[[5-(4-phenyldiazenylphenyl)furan-2-yl]methylidene]pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)NC(=O)/C1=C/c1ccc(-c2ccc(/N=N/c3ccccc3)cc2)o1 |
| InChI | InChI=1S/C24H16N4O3/c1-15-20(23(29)26-24(30)21(15)14-25)13-19-11-12-22(31-19)16-7-9-18(10-8-16)28-27-17-5-3-2-4-6-17/h2-13H,1H3,(H,26,29,30)/b20-13+,28-27+ |
| InChIKey | LIWFSSGVNNHWIJ-XZTRYBJTSA-N |
| XLogP | 5.24 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|