C19H11N2O5- — CID 3472759
2-[5-[(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate (PubChem CID 3472759) has the molecular formula C19H11N2O5- and a molecular weight of 347.31 g/mol. Its IUPAC name is 2-[5-[(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | 2-[5-[(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 3472759 |
| Molecular Formula | C19H11N2O5- |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 2-[5-[(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
| SMILES | CC1=C(C#N)C(=O)NC(=O)C1=Cc1ccc(-c2ccccc2C(=O)[O-])o1 |
| InChI | InChI=1S/C19H12N2O5/c1-10-14(17(22)21-18(23)15(10)9-20)8-11-6-7-16(26-11)12-4-2-3-5-13(12)19(24)25/h2-8H,1H3,(H,24,25)(H,21,22,23)/p-1 |
| InChIKey | QFSBWMPPUNFUEN-UHFFFAOYSA-M |
| XLogP | 1.19 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|