C24H16N6O10 — CID 135708521
N,N'-bis[(Z)-[5-(4-hydroxy-3-nitrophenyl)furan-2-yl]methylideneamino]oxamide (PubChem CID 135708521) has the molecular formula C24H16N6O10 and a molecular weight of 548.42 g/mol. Its IUPAC name is N,N'-bis[(Z)-[5-(4-hydroxy-3-nitrophenyl)furan-2-yl]methylideneamino]oxamide.
| Compound Name | N,N'-bis[(Z)-[5-(4-hydroxy-3-nitrophenyl)furan-2-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 135708521 |
| Molecular Formula | C24H16N6O10 |
| Molecular Weight | 548.42 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | N,N'-bis[(Z)-[5-(4-hydroxy-3-nitrophenyl)furan-2-yl]methylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1ccc(-c2ccc(O)c([N+](=O)[O-])c2)o1)C(=O)N/N=C\c1ccc(-c2ccc(O)c([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C24H16N6O10/c31-19-5-1-13(9-17(19)29(35)36)21-7-3-15(39-21)11-25-27-23(33)24(34)28-26-12-16-4-8-22(40-16)14-2-6-20(32)18(10-14)30(37)38/h1-12,31-32H,(H,27,33)(H,28,34)/b25-11-,26-12- |
| InChIKey | BSPWGJOMCQPKOY-RSKRUZOQSA-N |
| XLogP | 3.03 |
| TPSA | 235.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|