C10H6BrIN2O2S — CID 2880632
5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 2880632) has the molecular formula C10H6BrIN2O2S and a molecular weight of 425.05 g/mol. Its IUPAC name is 5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 2880632 |
| Molecular Formula | C10H6BrIN2O2S |
| Molecular Weight | 425.05 g/mol |
| Exact Mass | 423.84 |
| IUPAC Name | 5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1NC(=S)NC1=Cc1cc(Br)c(O)c(I)c1 |
| InChI | InChI=1S/C10H6BrIN2O2S/c11-5-1-4(2-6(12)8(5)15)3-7-9(16)14-10(17)13-7/h1-3,15H,(H2,13,14,16,17) |
| InChIKey | BSPHXAUMDMRPET-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.05 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|