C11H8Br2N2O3S — CID 3146363
2-amino-5-[(3,5-dibromo-2-hydroxy-4-methoxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 3146363) has the molecular formula C11H8Br2N2O3S and a molecular weight of 408.07 g/mol. Its IUPAC name is 2-amino-5-[(3,5-dibromo-2-hydroxy-4-methoxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[(3,5-dibromo-2-hydroxy-4-methoxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 3146363 |
| Molecular Formula | C11H8Br2N2O3S |
| Molecular Weight | 408.07 g/mol |
| Exact Mass | 405.86 |
| IUPAC Name | 2-amino-5-[(3,5-dibromo-2-hydroxy-4-methoxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | COc1c(Br)cc(C=C2SC(N)=NC2=O)c(O)c1Br |
| InChI | InChI=1S/C11H8Br2N2O3S/c1-18-9-5(12)2-4(8(16)7(9)13)3-6-10(17)15-11(14)19-6/h2-3,16H,1H3,(H2,14,15,17) |
| InChIKey | RSIZHIIWKFODSA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.07 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|