C17H11Br2NO3S — CID 171983299
(5E)-5-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2-(4-methylphenyl)-1,3-thiazol-4-one (PubChem CID 171983299) has the molecular formula C17H11Br2NO3S and a molecular weight of 469.15 g/mol. Its IUPAC name is (5E)-5-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2-(4-methylphenyl)-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2-(4-methylphenyl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 171983299 |
| Molecular Formula | C17H11Br2NO3S |
| Molecular Weight | 469.15 g/mol |
| Exact Mass | 466.88 |
| IUPAC Name | (5E)-5-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2-(4-methylphenyl)-1,3-thiazol-4-one |
| SMILES | Cc1ccc(C2=NC(=O)/C(=C\c3cc(Br)c(O)c(Br)c3O)S2)cc1 |
| InChI | InChI=1S/C17H11Br2NO3S/c1-8-2-4-9(5-3-8)17-20-16(23)12(24-17)7-10-6-11(18)15(22)13(19)14(10)21/h2-7,21-22H,1H3/b12-7+ |
| InChIKey | VAGJFSBVJNYKPL-KPKJPENVSA-N |
| XLogP | 4.99 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.15 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|