C13H12Br2FNO2S2 — CID 143842472
(5Z)-5-[(3,5-dibromo-4-fluoro-2-hydroxyphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-4-one;ethane (PubChem CID 143842472) has the molecular formula C13H12Br2FNO2S2 and a molecular weight of 457.18 g/mol. Its IUPAC name is (5Z)-5-[(3,5-dibromo-4-fluoro-2-hydroxyphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-4-one;ethane.
| Compound Name | (5Z)-5-[(3,5-dibromo-4-fluoro-2-hydroxyphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-4-one;ethane |
|---|---|
| PubChem CID | 143842472 |
| Molecular Formula | C13H12Br2FNO2S2 |
| Molecular Weight | 457.18 g/mol |
| Exact Mass | 454.87 |
| IUPAC Name | (5Z)-5-[(3,5-dibromo-4-fluoro-2-hydroxyphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-4-one;ethane |
| SMILES | CC.CSC1=NC(=O)/C(=C/c2cc(Br)c(F)c(Br)c2O)S1 |
| InChI | InChI=1S/C11H6Br2FNO2S2.C2H6/c1-18-11-15-10(17)6(19-11)3-4-2-5(12)8(14)7(13)9(4)16;1-2/h2-3,16H,1H3;1-2H3/b6-3-; |
| InChIKey | STNJUQACDRALTP-AQPBACSKSA-N |
| XLogP | 5.42 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.18 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|