C11H7I2NO2S2 — CID 10577413
(5Z)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-4-one (PubChem CID 10577413) has the molecular formula C11H7I2NO2S2 and a molecular weight of 503.12 g/mol. Its IUPAC name is (5Z)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 10577413 |
| Molecular Formula | C11H7I2NO2S2 |
| Molecular Weight | 503.12 g/mol |
| Exact Mass | 502.80 |
| IUPAC Name | (5Z)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-4-one |
| SMILES | CSC1=NC(=O)/C(=C/c2cc(I)c(O)c(I)c2)S1 |
| InChI | InChI=1S/C11H7I2NO2S2/c1-17-11-14-10(16)8(18-11)4-5-2-6(12)9(15)7(13)3-5/h2-4,15H,1H3/b8-4- |
| InChIKey | VQZQZFPVFHHLBD-YWEYNIOJSA-N |
| XLogP | 3.93 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.12 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|