C17H13NOS — CID 175143349
5-[(2-methylphenyl)methylidene]-2-phenyl-1,3-thiazol-4-one (PubChem CID 175143349) has the molecular formula C17H13NOS and a molecular weight of 279.36 g/mol. Its IUPAC name is 5-[(2-methylphenyl)methylidene]-2-phenyl-1,3-thiazol-4-one.
| Compound Name | 5-[(2-methylphenyl)methylidene]-2-phenyl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 175143349 |
| Molecular Formula | C17H13NOS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 5-[(2-methylphenyl)methylidene]-2-phenyl-1,3-thiazol-4-one |
| SMILES | Cc1ccccc1C=C1SC(c2ccccc2)=NC1=O |
| InChI | InChI=1S/C17H13NOS/c1-12-7-5-6-10-14(12)11-15-16(19)18-17(20-15)13-8-3-2-4-9-13/h2-11H,1H3 |
| InChIKey | XIZKEMTYZANEHK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|