C20H16IN3O6S — CID 126031375
N-[(5Z)-5-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide (PubChem CID 126031375) has the molecular formula C20H16IN3O6S and a molecular weight of 553.33 g/mol. Its IUPAC name is N-[(5Z)-5-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[(5Z)-5-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 126031375 |
| Molecular Formula | C20H16IN3O6S |
| Molecular Weight | 553.33 g/mol |
| Exact Mass | 552.98 |
| IUPAC Name | N-[(5Z)-5-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1cc(/C=C2\SC(NC(C)=O)=NC2=O)cc(I)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H16IN3O6S/c1-11(25)22-20-23-19(26)17(31-20)9-13-7-15(21)18(16(8-13)29-2)30-10-12-3-5-14(6-4-12)24(27)28/h3-9H,10H2,1-2H3,(H,22,23,25,26)/b17-9- |
| InChIKey | HKVKXSXGADMWAP-MFOYZWKCSA-N |
| XLogP | 3.89 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|