C26H20IN3O7 — CID 19666509
N-[4-[(4Z)-4-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide (PubChem CID 19666509) has the molecular formula C26H20IN3O7 and a molecular weight of 613.36 g/mol. Its IUPAC name is N-[4-[(4Z)-4-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[(4Z)-4-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 19666509 |
| Molecular Formula | C26H20IN3O7 |
| Molecular Weight | 613.36 g/mol |
| Exact Mass | 613.03 |
| IUPAC Name | N-[4-[(4Z)-4-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(NC(C)=O)cc3)OC2=O)cc(I)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H20IN3O7/c1-15(31)28-19-7-5-18(6-8-19)25-29-22(26(32)37-25)12-17-11-21(27)24(23(13-17)35-2)36-14-16-3-9-20(10-4-16)30(33)34/h3-13H,14H2,1-2H3,(H,28,31)/b22-12- |
| InChIKey | ISTUEPOORQKSGE-UUYOSTAYSA-N |
| XLogP | 5.09 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|