C29H18I2N2O5 — CID 19665586
(4Z)-4-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-phenylphenyl)-1,3-oxazol-5-one (PubChem CID 19665586) has the molecular formula C29H18I2N2O5 and a molecular weight of 728.28 g/mol. Its IUPAC name is (4Z)-4-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-phenylphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-phenylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19665586 |
| Molecular Formula | C29H18I2N2O5 |
| Molecular Weight | 728.28 g/mol |
| Exact Mass | 727.93 |
| IUPAC Name | (4Z)-4-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-phenylphenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(-c3ccccc3)cc2)=N/C1=C\c1cc(I)c(OCc2ccc([N+](=O)[O-])cc2)c(I)c1 |
| InChI | InChI=1S/C29H18I2N2O5/c30-24-14-19(15-25(31)27(24)37-17-18-6-12-23(13-7-18)33(35)36)16-26-29(34)38-28(32-26)22-10-8-21(9-11-22)20-4-2-1-3-5-20/h1-16H,17H2/b26-16- |
| InChIKey | UVEVFSRGBCNGKE-QQXSKIMKSA-N |
| XLogP | 7.39 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.28 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|