C14H11BrN2O6 — CID 1220912
[5-bromo-2-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] acetate (PubChem CID 1220912) has the molecular formula C14H11BrN2O6 and a molecular weight of 383.15 g/mol. Its IUPAC name is [5-bromo-2-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] acetate.
| Compound Name | [5-bromo-2-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 1220912 |
| Molecular Formula | C14H11BrN2O6 |
| Molecular Weight | 383.15 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | [5-bromo-2-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] acetate |
| SMILES | COc1cc(C=C2C(=O)NC(=O)NC2=O)c(Br)cc1OC(C)=O |
| InChI | InChI=1S/C14H11BrN2O6/c1-6(18)23-11-5-9(15)7(4-10(11)22-2)3-8-12(19)16-14(21)17-13(8)20/h3-5H,1-2H3,(H2,16,17,19,20,21) |
| InChIKey | GIHTZYZMVKLWKF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.15 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|