C13H13BrN2O4 — CID 697114
(5Z)-5-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 697114) has the molecular formula C13H13BrN2O4 and a molecular weight of 341.16 g/mol. Its IUPAC name is (5Z)-5-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 697114 |
| Molecular Formula | C13H13BrN2O4 |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | (5Z)-5-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2\NC(=O)NC2=O)c(Br)cc1OC |
| InChI | InChI=1S/C13H13BrN2O4/c1-3-20-11-5-7(8(14)6-10(11)19-2)4-9-12(17)16-13(18)15-9/h4-6H,3H2,1-2H3,(H2,15,16,17,18)/b9-4- |
| InChIKey | BPHGEPHHQVQROL-WTKPLQERSA-N |
| XLogP | 2.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|