C15H14Br2N2O4 — CID 19579099
(5Z)-5-[(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 19579099) has the molecular formula C15H14Br2N2O4 and a molecular weight of 446.10 g/mol. Its IUPAC name is (5Z)-5-[(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 19579099 |
| Molecular Formula | C15H14Br2N2O4 |
| Molecular Weight | 446.10 g/mol |
| Exact Mass | 443.93 |
| IUPAC Name | (5Z)-5-[(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | C=CCOc1c(OCC)cc(/C=C2\NC(=O)NC2=O)c(Br)c1Br |
| InChI | InChI=1S/C15H14Br2N2O4/c1-3-5-23-13-10(22-4-2)7-8(11(16)12(13)17)6-9-14(20)19-15(21)18-9/h3,6-7H,1,4-5H2,2H3,(H2,18,19,20,21)/b9-6- |
| InChIKey | GHFRXXSJCDGDBP-TWGQIWQCSA-N |
| XLogP | 3.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.10 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|