C19H22Br2O6 — CID 168599377
5-[(2,3-dibromo-4-butoxy-5-ethoxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168599377) has the molecular formula C19H22Br2O6 and a molecular weight of 506.19 g/mol. Its IUPAC name is 5-[(2,3-dibromo-4-butoxy-5-ethoxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2,3-dibromo-4-butoxy-5-ethoxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168599377 |
| Molecular Formula | C19H22Br2O6 |
| Molecular Weight | 506.19 g/mol |
| Exact Mass | 503.98 |
| IUPAC Name | 5-[(2,3-dibromo-4-butoxy-5-ethoxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCCCOc1c(OCC)cc(C=C2C(=O)OC(C)(C)OC2=O)c(Br)c1Br |
| InChI | InChI=1S/C19H22Br2O6/c1-5-7-8-25-16-13(24-6-2)10-11(14(20)15(16)21)9-12-17(22)26-19(3,4)27-18(12)23/h9-10H,5-8H2,1-4H3 |
| InChIKey | WMCXROAWUNCTKK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.19 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|