C12H15Br2NO3 — CID 57360359
N-[(2,3-dibromo-5-ethoxy-4-propoxyphenyl)methylidene]hydroxylamine (PubChem CID 57360359) has the molecular formula C12H15Br2NO3 and a molecular weight of 381.06 g/mol. Its IUPAC name is N-[(2,3-dibromo-5-ethoxy-4-propoxyphenyl)methylidene]hydroxylamine.
| Compound Name | N-[(2,3-dibromo-5-ethoxy-4-propoxyphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 57360359 |
| Molecular Formula | C12H15Br2NO3 |
| Molecular Weight | 381.06 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | N-[(2,3-dibromo-5-ethoxy-4-propoxyphenyl)methylidene]hydroxylamine |
| SMILES | CCCOc1c(OCC)cc(C=NO)c(Br)c1Br |
| InChI | InChI=1S/C12H15Br2NO3/c1-3-5-18-12-9(17-4-2)6-8(7-15-16)10(13)11(12)14/h6-7,16H,3-5H2,1-2H3 |
| InChIKey | JQWCUVXACVOZMJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.06 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|