C17H18BrNO7 — CID 168599825
2-[2-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-6-ethoxyphenoxy]acetamide (PubChem CID 168599825) has the molecular formula C17H18BrNO7 and a molecular weight of 428.24 g/mol. Its IUPAC name is 2-[2-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-6-ethoxyphenoxy]acetamide.
| Compound Name | 2-[2-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-6-ethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 168599825 |
| Molecular Formula | C17H18BrNO7 |
| Molecular Weight | 428.24 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 2-[2-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-6-ethoxyphenoxy]acetamide |
| SMILES | CCOc1cc(C=C2C(=O)OC(C)(C)OC2=O)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C17H18BrNO7/c1-4-23-12-7-9(6-11(18)14(12)24-8-13(19)20)5-10-15(21)25-17(2,3)26-16(10)22/h5-7H,4,8H2,1-3H3,(H2,19,20) |
| InChIKey | JJJWXJWMFQEZIU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|