C22H21IN2O4 — CID 126062878
(5E)-5-[[3-ethoxy-4-[(4-iodophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 126062878) has the molecular formula C22H21IN2O4 and a molecular weight of 504.32 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-4-[(4-iodophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-ethoxy-4-[(4-iodophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126062878 |
| Molecular Formula | C22H21IN2O4 |
| Molecular Weight | 504.32 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | (5E)-5-[[3-ethoxy-4-[(4-iodophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | C=CCc1cc(/C=C2/NC(=O)NC2=O)cc(OCC)c1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C22H21IN2O4/c1-3-5-16-10-15(11-18-21(26)25-22(27)24-18)12-19(28-4-2)20(16)29-13-14-6-8-17(23)9-7-14/h3,6-12H,1,4-5,13H2,2H3,(H2,24,25,26,27)/b18-11+ |
| InChIKey | MJEWQECACUHTJW-WOJGMQOQSA-N |
| XLogP | 4.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|