C19H16ClFN2O4 — CID 1319896
(5E)-5-[[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 1319896) has the molecular formula C19H16ClFN2O4 and a molecular weight of 390.80 g/mol. Its IUPAC name is (5E)-5-[[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 1319896 |
| Molecular Formula | C19H16ClFN2O4 |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (5E)-5-[[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/NC(=O)NC2=O)cc(Cl)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H16ClFN2O4/c1-2-26-16-9-12(8-15-18(24)23-19(25)22-15)7-14(20)17(16)27-10-11-3-5-13(21)6-4-11/h3-9H,2,10H2,1H3,(H2,22,23,24,25)/b15-8+ |
| InChIKey | PKACNPOIXRYCTD-OVCLIPMQSA-N |
| XLogP | 3.64 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|