C12H11ClN2O4 — CID 3264930
5-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 3264930) has the molecular formula C12H11ClN2O4 and a molecular weight of 282.68 g/mol. Its IUPAC name is 5-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | 5-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 3264930 |
| Molecular Formula | C12H11ClN2O4 |
| Molecular Weight | 282.68 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 5-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | CCOc1cc(C=C2NC(=O)NC2=O)cc(Cl)c1O |
| InChI | InChI=1S/C12H11ClN2O4/c1-2-19-9-5-6(3-7(13)10(9)16)4-8-11(17)15-12(18)14-8/h3-5,16H,2H2,1H3,(H2,14,15,17,18) |
| InChIKey | UALCVDWPZVEKJF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.68 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|