C19H16Cl2N2O4 — CID 2284957
(5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 2284957) has the molecular formula C19H16Cl2N2O4 and a molecular weight of 407.25 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2284957 |
| Molecular Formula | C19H16Cl2N2O4 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2\NC(=O)NC2=O)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O4/c1-2-26-17-8-11(7-15-18(24)23-19(25)22-15)3-6-16(17)27-10-12-4-5-13(20)9-14(12)21/h3-9H,2,10H2,1H3,(H2,22,23,24,25)/b15-7- |
| InChIKey | PZWFCIYBKKSYKL-CHHVJCJISA-N |
| XLogP | 4.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|