C21H20Cl2O6 — CID 1362230
dimethyl 2-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]propanedioate (PubChem CID 1362230) has the molecular formula C21H20Cl2O6 and a molecular weight of 439.29 g/mol. Its IUPAC name is dimethyl 2-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 1362230 |
| Molecular Formula | C21H20Cl2O6 |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | dimethyl 2-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]propanedioate |
| SMILES | CCOc1cc(C=C(C(=O)OC)C(=O)OC)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H20Cl2O6/c1-4-28-19-10-13(9-16(20(24)26-2)21(25)27-3)5-8-18(19)29-12-14-6-7-15(22)11-17(14)23/h5-11H,4,12H2,1-3H3 |
| InChIKey | AXTRLJWZZOXXGH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|