C23H21Cl2NO2 — CID 126207064
1-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(4-methylphenyl)methanimine (PubChem CID 126207064) has the molecular formula C23H21Cl2NO2 and a molecular weight of 414.33 g/mol. Its IUPAC name is 1-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(4-methylphenyl)methanimine.
| Compound Name | 1-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126207064 |
| Molecular Formula | C23H21Cl2NO2 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 1-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(4-methylphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc(C)cc2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H21Cl2NO2/c1-3-27-23-12-17(14-26-20-9-4-16(2)5-10-20)6-11-22(23)28-15-18-7-8-19(24)13-21(18)25/h4-14H,3,15H2,1-2H3/b26-14+ |
| InChIKey | JNDZMOLILQGBNS-VULFUBBASA-N |
| XLogP | 7.03 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|