C26H26Cl2N2O3S — CID 126154854
(2R)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-methylphenyl)sulfanylpropanamide (PubChem CID 126154854) has the molecular formula C26H26Cl2N2O3S and a molecular weight of 517.48 g/mol. Its IUPAC name is (2R)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-methylphenyl)sulfanylpropanamide.
| Compound Name | (2R)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 126154854 |
| Molecular Formula | C26H26Cl2N2O3S |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | (2R)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-methylphenyl)sulfanylpropanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@@H](C)Sc2ccc(C)cc2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H26Cl2N2O3S/c1-4-32-25-13-19(7-12-24(25)33-16-20-8-9-21(27)14-23(20)28)15-29-30-26(31)18(3)34-22-10-5-17(2)6-11-22/h5-15,18H,4,16H2,1-3H3,(H,30,31)/b29-15-/t18-/m1/s1 |
| InChIKey | QOQHSMZANMSXSS-AQCJKUNZSA-N |
| XLogP | 6.91 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|