C24H22Cl3NO2 — CID 126206428
1-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-N-(2,5-dimethylphenyl)methanimine (PubChem CID 126206428) has the molecular formula C24H22Cl3NO2 and a molecular weight of 462.80 g/mol. Its IUPAC name is 1-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-N-(2,5-dimethylphenyl)methanimine.
| Compound Name | 1-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-N-(2,5-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126206428 |
| Molecular Formula | C24H22Cl3NO2 |
| Molecular Weight | 462.80 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 1-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-N-(2,5-dimethylphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2cc(C)ccc2C)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H22Cl3NO2/c1-4-29-23-11-17(13-28-22-9-15(2)5-6-16(22)3)10-21(27)24(23)30-14-18-7-8-19(25)12-20(18)26/h5-13H,4,14H2,1-3H3/b28-13+ |
| InChIKey | GZDWNUKCBWCNHB-XODNFHPESA-N |
| XLogP | 7.99 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.80 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|