C27H24ClNO2 — CID 126217219
1-[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-N-(4-methylphenyl)methanimine (PubChem CID 126217219) has the molecular formula C27H24ClNO2 and a molecular weight of 429.95 g/mol. Its IUPAC name is 1-[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-N-(4-methylphenyl)methanimine.
| Compound Name | 1-[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-N-(4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126217219 |
| Molecular Formula | C27H24ClNO2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 1-[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-N-(4-methylphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc(C)cc2)cc(Cl)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C27H24ClNO2/c1-3-30-26-16-20(17-29-23-13-11-19(2)12-14-23)15-25(28)27(26)31-18-22-9-6-8-21-7-4-5-10-24(21)22/h4-17H,3,18H2,1-2H3/b29-17+ |
| InChIKey | LTALJHNWNWPSID-STBIYBPSSA-N |
| XLogP | 7.53 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|