C23H24Cl2N2O5 — CID 46499331
(5Z)-5-[[3-chloro-4-[3-(4-chloro-3,5-dimethylphenoxy)propoxy]-5-ethoxyphenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 46499331) has the molecular formula C23H24Cl2N2O5 and a molecular weight of 479.36 g/mol. Its IUPAC name is (5Z)-5-[[3-chloro-4-[3-(4-chloro-3,5-dimethylphenoxy)propoxy]-5-ethoxyphenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-chloro-4-[3-(4-chloro-3,5-dimethylphenoxy)propoxy]-5-ethoxyphenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46499331 |
| Molecular Formula | C23H24Cl2N2O5 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | (5Z)-5-[[3-chloro-4-[3-(4-chloro-3,5-dimethylphenoxy)propoxy]-5-ethoxyphenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2\NC(=O)NC2=O)cc(Cl)c1OCCCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C23H24Cl2N2O5/c1-4-30-19-12-15(11-18-22(28)27-23(29)26-18)10-17(24)21(19)32-7-5-6-31-16-8-13(2)20(25)14(3)9-16/h8-12H,4-7H2,1-3H3,(H2,26,27,28,29)/b18-11- |
| InChIKey | WQPONXPQUJKECF-WQRHYEAKSA-N |
| XLogP | 5.04 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|