C18H14BrFN2O4 — CID 1329690
(5E)-5-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 1329690) has the molecular formula C18H14BrFN2O4 and a molecular weight of 421.22 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 1329690 |
| Molecular Formula | C18H14BrFN2O4 |
| Molecular Weight | 421.22 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | (5E)-5-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/NC(=O)NC2=O)cc(Br)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H14BrFN2O4/c1-25-15-8-11(7-14-17(23)22-18(24)21-14)6-13(19)16(15)26-9-10-2-4-12(20)5-3-10/h2-8H,9H2,1H3,(H2,21,22,23,24)/b14-7+ |
| InChIKey | BRLYXEAUPKZQMA-VGOFMYFVSA-N |
| XLogP | 3.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|