C16H17BrN2O5 — CID 1012411
[4-[(4S)-5-acetyl-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidin-4-yl]-5-bromo-2-methoxyphenyl] acetate (PubChem CID 1012411) has the molecular formula C16H17BrN2O5 and a molecular weight of 397.23 g/mol. Its IUPAC name is [4-[(4S)-5-acetyl-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidin-4-yl]-5-bromo-2-methoxyphenyl] acetate.
| Compound Name | [4-[(4S)-5-acetyl-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidin-4-yl]-5-bromo-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 1012411 |
| Molecular Formula | C16H17BrN2O5 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | [4-[(4S)-5-acetyl-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidin-4-yl]-5-bromo-2-methoxyphenyl] acetate |
| SMILES | COc1cc([C@H]2NC(=O)NC(C)=C2C(C)=O)c(Br)cc1OC(C)=O |
| InChI | InChI=1S/C16H17BrN2O5/c1-7-14(8(2)20)15(19-16(22)18-7)10-5-12(23-4)13(6-11(10)17)24-9(3)21/h5-6,15H,1-4H3,(H2,18,19,22)/t15-/m1/s1 |
| InChIKey | PQDLYIIVZMOQCK-OAHLLOKOSA-N |
| XLogP | 2.60 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|