C21H17BrO7 — CID 168599407
[5-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-methoxyphenyl] benzoate (PubChem CID 168599407) has the molecular formula C21H17BrO7 and a molecular weight of 461.26 g/mol. Its IUPAC name is [5-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-methoxyphenyl] benzoate.
| Compound Name | [5-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 168599407 |
| Molecular Formula | C21H17BrO7 |
| Molecular Weight | 461.26 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | [5-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-methoxyphenyl] benzoate |
| SMILES | COc1cc(C=C2C(=O)OC(C)(C)OC2=O)c(Br)cc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H17BrO7/c1-21(2)28-19(24)14(20(25)29-21)9-13-10-16(26-3)17(11-15(13)22)27-18(23)12-7-5-4-6-8-12/h4-11H,1-3H3 |
| InChIKey | JLNUPWAKGOQDNW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|