About [3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate
[3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 2252971) has the molecular formula C16H11ClN2O4S2
and a molecular weight of 394.86 g/mol. Its IUPAC name is [3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | [3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
| PubChem CID | 2252971 |
| Molecular Formula | C16H11ClN2O4S2 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | [3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | NC1=NC(=O)/C(=C\c2cccc(OS(=O)(=O)c3ccc(Cl)cc3)c2)S1 |
| InChI | InChI=1S/C16H11ClN2O4S2/c17-11-4-6-13(7-5-11)25(21,22)23-12-3-1-2-10(8-12)9-14-15(20)19-16(18)24-14/h1-9H,(H2,18,19,20)/b14-9+ |
| InChIKey | SBIKOYZDTRNEMX-NTEUORMPSA-N |
| XLogP | 3.04 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate?
The IUPAC name of [3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate (CID 2252971) is [3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate.
What is the SMILES notation for [3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate?
The canonical SMILES for [3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate is NC1=NC(=O)/C(=C\c2cccc(OS(=O)(=O)c3ccc(Cl)cc3)c2)S1.
What is the InChIKey of [3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate?
The InChIKey is SBIKOYZDTRNEMX-NTEUORMPSA-N. The full InChI is InChI=1S/C16H11ClN2O4S2/c17-11-4-6-13(7-5-11)25(21,22)23-12-3-1-2-10(8-12)9-14-15(20)19-16(18)24-14/h1-9H,(H2,18,19,20)/b14-9+.
What are the key properties of [3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate?
[3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate has a molecular weight of 394.86 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate is sourced from PubChem (CID 2252971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).