C17H14N2O4S2 — CID 2885442
[2-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 2885442) has the molecular formula C17H14N2O4S2 and a molecular weight of 374.44 g/mol. Its IUPAC name is [2-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2885442 |
| Molecular Formula | C17H14N2O4S2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | [2-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2C=C2SC(N)=NC2=O)cc1 |
| InChI | InChI=1S/C17H14N2O4S2/c1-11-6-8-13(9-7-11)25(21,22)23-14-5-3-2-4-12(14)10-15-16(20)19-17(18)24-15/h2-10H,1H3,(H2,18,19,20) |
| InChIKey | OYKXXMIIXSEYJP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|