C26H20N4O4S2 — CID 3969878
[2-[[5-imino-2-(4-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 3969878) has the molecular formula C26H20N4O4S2 and a molecular weight of 516.60 g/mol. Its IUPAC name is [2-[[5-imino-2-(4-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[[5-imino-2-(4-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 3969878 |
| Molecular Formula | C26H20N4O4S2 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | [2-[[5-imino-2-(4-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | [H]/N=C1\C(=Cc2ccccc2OS(=O)(=O)c2ccc(C)cc2)C(=O)N=C2SC(c3ccc(C)cc3)=NN21 |
| InChI | InChI=1S/C26H20N4O4S2/c1-16-7-11-18(12-8-16)25-29-30-23(27)21(24(31)28-26(30)35-25)15-19-5-3-4-6-22(19)34-36(32,33)20-13-9-17(2)10-14-20/h3-15,27H,1-2H3/b21-15?,27-23+ |
| InChIKey | ONAXKDBZXOTTSB-HCVGOVOBSA-N |
| XLogP | 4.74 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|