C27H21ClN4O5S2 — CID 46742053
[2-chloro-4-[(E)-[5-imino-2-(4-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]-6-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 46742053) has the molecular formula C27H21ClN4O5S2 and a molecular weight of 581.08 g/mol. Its IUPAC name is [2-chloro-4-[(E)-[5-imino-2-(4-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]-6-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-chloro-4-[(E)-[5-imino-2-(4-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]-6-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 46742053 |
| Molecular Formula | C27H21ClN4O5S2 |
| Molecular Weight | 581.08 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | [2-chloro-4-[(E)-[5-imino-2-(4-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]-6-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | [H]/N=C1C(=C\c2cc(Cl)c(OS(=O)(=O)c3ccc(C)cc3)c(OC)c2)/C(=O)N=C2SC(c3ccc(C)cc3)=NN2/1 |
| InChI | InChI=1S/C27H21ClN4O5S2/c1-15-4-8-18(9-5-15)26-31-32-24(29)20(25(33)30-27(32)38-26)12-17-13-21(28)23(22(14-17)36-3)37-39(34,35)19-10-6-16(2)7-11-19/h4-14,29H,1-3H3/b20-12+,29-24- |
| InChIKey | ALRKPZZBFHAPPA-LPWUMQPCSA-N |
| XLogP | 5.40 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.08 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|