C20H20N2O3S — CID 2277546
(5Z)-2-amino-5-[[2-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 2277546) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is (5Z)-2-amino-5-[[2-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-amino-5-[[2-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2277546 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (5Z)-2-amino-5-[[2-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1cc(C)cc(OCCOc2ccccc2/C=C2\SC(N)=NC2=O)c1 |
| InChI | InChI=1S/C20H20N2O3S/c1-13-9-14(2)11-16(10-13)24-7-8-25-17-6-4-3-5-15(17)12-18-19(23)22-20(21)26-18/h3-6,9-12H,7-8H2,1-2H3,(H2,21,22,23)/b18-12- |
| InChIKey | DMLDMIVENZDJSX-PDGQHHTCSA-N |
| XLogP | 3.69 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|