C20H18Cl2N2O3S — CID 2277918
(5Z)-2-amino-5-[[3,5-dichloro-2-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 2277918) has the molecular formula C20H18Cl2N2O3S and a molecular weight of 437.35 g/mol. Its IUPAC name is (5Z)-2-amino-5-[[3,5-dichloro-2-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-amino-5-[[3,5-dichloro-2-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2277918 |
| Molecular Formula | C20H18Cl2N2O3S |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | (5Z)-2-amino-5-[[3,5-dichloro-2-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1cc(C)cc(OCCOc2c(Cl)cc(Cl)cc2/C=C2\SC(N)=NC2=O)c1 |
| InChI | InChI=1S/C20H18Cl2N2O3S/c1-11-5-12(2)7-15(6-11)26-3-4-27-18-13(8-14(21)10-16(18)22)9-17-19(25)24-20(23)28-17/h5-10H,3-4H2,1-2H3,(H2,23,24,25)/b17-9- |
| InChIKey | OJDGKHOAYVRRKV-MFOYZWKCSA-N |
| XLogP | 5.00 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|