C20H19ClN2O5S — CID 2895415
2-amino-5-[[3-chloro-5-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 2895415) has the molecular formula C20H19ClN2O5S and a molecular weight of 434.90 g/mol. Its IUPAC name is 2-amino-5-[[3-chloro-5-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[[3-chloro-5-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2895415 |
| Molecular Formula | C20H19ClN2O5S |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 2-amino-5-[[3-chloro-5-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | COc1ccc(OCCOc2c(Cl)cc(C=C3SC(N)=NC3=O)cc2OC)cc1 |
| InChI | InChI=1S/C20H19ClN2O5S/c1-25-13-3-5-14(6-4-13)27-7-8-28-18-15(21)9-12(10-16(18)26-2)11-17-19(24)23-20(22)29-17/h3-6,9-11H,7-8H2,1-2H3,(H2,22,23,24) |
| InChIKey | YGUSKYFTMSHLDN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|