C25H27BrN2O4S — CID 56727021
(5E)-2-amino-5-[[3-bromo-4-[2-(4-cyclohexylphenoxy)ethoxy]-5-methoxyphenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 56727021) has the molecular formula C25H27BrN2O4S and a molecular weight of 531.47 g/mol. Its IUPAC name is (5E)-2-amino-5-[[3-bromo-4-[2-(4-cyclohexylphenoxy)ethoxy]-5-methoxyphenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5E)-2-amino-5-[[3-bromo-4-[2-(4-cyclohexylphenoxy)ethoxy]-5-methoxyphenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 56727021 |
| Molecular Formula | C25H27BrN2O4S |
| Molecular Weight | 531.47 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | (5E)-2-amino-5-[[3-bromo-4-[2-(4-cyclohexylphenoxy)ethoxy]-5-methoxyphenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2/SC(N)=NC2=O)cc(Br)c1OCCOc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H27BrN2O4S/c1-30-21-14-16(15-22-24(29)28-25(27)33-22)13-20(26)23(21)32-12-11-31-19-9-7-18(8-10-19)17-5-3-2-4-6-17/h7-10,13-15,17H,2-6,11-12H2,1H3,(H2,27,28,29)/b22-15+ |
| InChIKey | FNRRHBFEUGBZQO-PXLXIMEGSA-N |
| XLogP | 5.89 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|