C22H23BrN2O4S — CID 23099181
[4-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-bromo-6-methoxyphenyl] adamantane-1-carboxylate (PubChem CID 23099181) has the molecular formula C22H23BrN2O4S and a molecular weight of 491.41 g/mol. Its IUPAC name is [4-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-bromo-6-methoxyphenyl] adamantane-1-carboxylate.
| Compound Name | [4-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-bromo-6-methoxyphenyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 23099181 |
| Molecular Formula | C22H23BrN2O4S |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | [4-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-bromo-6-methoxyphenyl] adamantane-1-carboxylate |
| SMILES | COc1cc(/C=C2/SC(N)=NC2=O)cc(Br)c1OC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H23BrN2O4S/c1-28-16-6-11(7-17-19(26)25-21(24)30-17)5-15(23)18(16)29-20(27)22-8-12-2-13(9-22)4-14(3-12)10-22/h5-7,12-14H,2-4,8-10H2,1H3,(H2,24,25,26)/b17-7+ |
| InChIKey | DBUASEYFPRXPGY-REZTVBANSA-N |
| XLogP | 4.51 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|