C23H24BrNO4S2 — CID 50871964
[2-bromo-6-methoxy-4-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] adamantane-1-carboxylate (PubChem CID 50871964) has the molecular formula C23H24BrNO4S2 and a molecular weight of 522.49 g/mol. Its IUPAC name is [2-bromo-6-methoxy-4-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] adamantane-1-carboxylate.
| Compound Name | [2-bromo-6-methoxy-4-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 50871964 |
| Molecular Formula | C23H24BrNO4S2 |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | [2-bromo-6-methoxy-4-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] adamantane-1-carboxylate |
| SMILES | COc1cc(/C=C2/SC(=S)N(C)C2=O)cc(Br)c1OC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H24BrNO4S2/c1-25-20(26)18(31-22(25)30)8-12-6-16(24)19(17(7-12)28-2)29-21(27)23-9-13-3-14(10-23)5-15(4-13)11-23/h6-8,13-15H,3-5,9-11H2,1-2H3/b18-8+ |
| InChIKey | ZJYMWTJZJNQVRN-QGMBQPNBSA-N |
| XLogP | 5.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|